C18H22O4 — CID 67742471
(3aS,3bR,9aR,9bS,11aS)-6-hydroxy-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione (PubChem CID 67742471) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bS,11aS)-6-hydroxy-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione.
| Compound Name | (3aS,3bR,9aR,9bS,11aS)-6-hydroxy-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione |
|---|---|
| PubChem CID | 67742471 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3aS,3bR,9aR,9bS,11aS)-6-hydroxy-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione |
| SMILES | C[C@]12C=CC(=O)C(O)=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C18H22O4/c1-17-8-6-14(19)15(20)12(17)4-3-10-11(17)5-7-18(2)13(10)9-22-16(18)21/h6,8,10-11,13,20H,3-5,7,9H2,1-2H3/t10-,11+,13+,17-,18+/m1/s1 |
| InChIKey | QSDCADYWOOFKPR-VZCRFNGMSA-N |
| XLogP | 2.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |