C19H24O4 — CID 5224870
7-hydroxy-10a,12a-dimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromene-2,8-dione (PubChem CID 5224870) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 7-hydroxy-10a,12a-dimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromene-2,8-dione.
| Compound Name | 7-hydroxy-10a,12a-dimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 5224870 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 7-hydroxy-10a,12a-dimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromene-2,8-dione |
| SMILES | CC12CCC3C(CCC4=C(O)C(=O)C=CC43C)C1CCC(=O)O2 |
| InChI | InChI=1S/C19H24O4/c1-18-9-8-15(20)17(22)14(18)4-3-11-12(18)7-10-19(2)13(11)5-6-16(21)23-19/h8-9,11-13,22H,3-7,10H2,1-2H3 |
| InChIKey | FJDOPROIFCKSNU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |