C18H22O2 — CID 58655476
(12aS)-12a-methyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromen-2-one (PubChem CID 58655476) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (12aS)-12a-methyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromen-2-one.
| Compound Name | (12aS)-12a-methyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromen-2-one |
|---|---|
| PubChem CID | 58655476 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (12aS)-12a-methyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-naphtho[2,1-f]chromen-2-one |
| SMILES | C[C@]12CCC3c4ccccc4CCC3C1CCC(=O)O2 |
| InChI | InChI=1S/C18H22O2/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(19)20-18/h2-5,14-16H,6-11H2,1H3/t14?,15?,16?,18-/m0/s1 |
| InChIKey | YTAMTFAQGLMEAF-GUZDXLFXSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |