C18H27NO3S — CID 67413853
(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;sulfamic acid (PubChem CID 67413853) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is (8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;sulfamic acid.
| Compound Name | (8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;sulfamic acid |
|---|---|
| PubChem CID | 67413853 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;sulfamic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCc3ccccc3[C@H]1CC2.NS(=O)(=O)O |
| InChI | InChI=1S/C18H24.H3NO3S/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18;1-5(2,3)4/h2-3,5-6,15-17H,4,7-12H2,1H3;(H3,1,2,3,4)/t15-,16-,17+,18+;/m1./s1 |
| InChIKey | ZIROPCFUFGVIMV-IKXXDGBSSA-N |
| XLogP | 3.68 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|