C18H23F — CID 54530178
(8S,9S,13S,14S)-2-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 54530178) has the molecular formula C18H23F and a molecular weight of 258.38 g/mol. Its IUPAC name is (8S,9S,13S,14S)-2-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S)-2-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 54530178 |
| Molecular Formula | C18H23F |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (8S,9S,13S,14S)-2-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCc3ccc(F)cc3[C@H]1CC2 |
| InChI | InChI=1S/C18H23F/c1-18-9-2-3-17(18)15-7-5-12-4-6-13(19)11-16(12)14(15)8-10-18/h4,6,11,14-15,17H,2-3,5,7-10H2,1H3/t14-,15+,17-,18-/m0/s1 |
| InChIKey | YVYRJOHLCSREEP-MVJTYMMSSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |