C20H28O — CID 173075604
(4aS,4bS,10bS,12aS)-9-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene (PubChem CID 173075604) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (4aS,4bS,10bS,12aS)-9-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene.
| Compound Name | (4aS,4bS,10bS,12aS)-9-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene |
|---|---|
| PubChem CID | 173075604 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (4aS,4bS,10bS,12aS)-9-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene |
| SMILES | COc1ccc2c(c1)[C@H]1CC[C@]3(C)CCCC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C20H28O/c1-20-11-4-3-5-19(20)17-9-7-14-6-8-15(21-2)13-18(14)16(17)10-12-20/h6,8,13,16-17,19H,3-5,7,9-12H2,1-2H3/t16-,17+,19-,20-/m0/s1 |
| InChIKey | QTYCSVZWKKFQKZ-HNJRGHQBSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |