C19H24F2O — CID 154204484
(8S,9S,13R,14S)-16,16-difluoro-3-methoxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 154204484) has the molecular formula C19H24F2O and a molecular weight of 306.40 g/mol. Its IUPAC name is (8S,9S,13R,14S)-16,16-difluoro-3-methoxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13R,14S)-16,16-difluoro-3-methoxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154204484 |
| Molecular Formula | C19H24F2O |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (8S,9S,13R,14S)-16,16-difluoro-3-methoxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)CC(F)(F)C[C@@H]12 |
| InChI | InChI=1S/C19H24F2O/c1-18-8-7-15-14-6-4-13(22-2)9-12(14)3-5-16(15)17(18)10-19(20,21)11-18/h4,6,9,15-17H,3,5,7-8,10-11H2,1-2H3/t15-,16-,17+,18-/m1/s1 |
| InChIKey | WIIHTCMBCXEFLA-ZJPYXAASSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |