C19H26O3 — CID 154358673
[(8R,9S,13R,14S)-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanediol (PubChem CID 154358673) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(8R,9S,13R,14S)-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanediol.
| Compound Name | [(8R,9S,13R,14S)-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanediol |
|---|---|
| PubChem CID | 154358673 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(8R,9S,13R,14S)-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-13-yl]methanediol |
| SMILES | COc1ccc2c(c1)[C@H]1CC[C@]3(C(O)O)CCC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C19H26O3/c1-22-13-6-4-12-5-7-15-14(16(12)11-13)8-10-19(18(20)21)9-2-3-17(15)19/h4,6,11,14-15,17-18,20-21H,2-3,5,7-10H2,1H3/t14-,15+,17-,19+/m0/s1 |
| InChIKey | VJSFSTWQLPYYDK-JHDROBOHSA-N |
| XLogP | 3.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|