C18H23O4S- — CID 25202424
(13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) sulfate (PubChem CID 25202424) has the molecular formula C18H23O4S- and a molecular weight of 335.45 g/mol. Its IUPAC name is (13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) sulfate.
| Compound Name | (13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) sulfate |
|---|---|
| PubChem CID | 25202424 |
| Molecular Formula | C18H23O4S- |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) sulfate |
| SMILES | CC12CCCC1C1CCc3cc(OS(=O)(=O)[O-])ccc3C1CC2 |
| InChI | InChI=1S/C18H24O4S/c1-18-9-2-3-17(18)16-6-4-12-11-13(22-23(19,20)21)5-7-14(12)15(16)8-10-18/h5,7,11,15-17H,2-4,6,8-10H2,1H3,(H,19,20,21)/p-1 |
| InChIKey | KFFRVXQLZSOXIX-UHFFFAOYSA-M |
| XLogP | 3.77 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|