C19H25NO3S — CID 91586559
[(13S)-13-methyl-6-methylidene-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 91586559) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is [(13S)-13-methyl-6-methylidene-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(13S)-13-methyl-6-methylidene-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 91586559 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(13S)-13-methyl-6-methylidene-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | C=C1CC2C(CC[C@]3(C)CCCC23)c2ccc(OS(N)(=O)=O)cc21 |
| InChI | InChI=1S/C19H25NO3S/c1-12-10-17-15(7-9-19(2)8-3-4-18(17)19)14-6-5-13(11-16(12)14)23-24(20,21)22/h5-6,11,15,17-18H,1,3-4,7-10H2,2H3,(H2,20,21,22)/t15?,17?,18?,19-/m0/s1 |
| InChIKey | AGSJWBKOQYYRSA-LWRKGQLUSA-N |
| XLogP | 3.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |