C20H29NO5S — CID 10046235
[(6aS,12S)-12-hydroxy-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate (PubChem CID 10046235) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is [(6aS,12S)-12-hydroxy-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate.
| Compound Name | [(6aS,12S)-12-hydroxy-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate |
|---|---|
| PubChem CID | 10046235 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(6aS,12S)-12-hydroxy-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)[C@@H](O)CC1C2CC[C@]2(C)CCCCC12 |
| InChI | InChI=1S/C20H29NO5S/c1-20-7-4-3-5-16(20)14-9-17(22)15-11-19(26-27(21,23)24)18(25-2)10-13(15)12(14)6-8-20/h10-12,14,16-17,22H,3-9H2,1-2H3,(H2,21,23,24)/t12?,14?,16?,17-,20-/m0/s1 |
| InChIKey | DFPOHULXBRWOLQ-GKPULXPASA-N |
| XLogP | 3.40 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |