C22H32N2O5S — CID 68959927
[(6S,8S,9S,13S,14S)-6-acetamido-13-ethyl-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 68959927) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is [(6S,8S,9S,13S,14S)-6-acetamido-13-ethyl-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(6S,8S,9S,13S,14S)-6-acetamido-13-ethyl-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 68959927 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [(6S,8S,9S,13S,14S)-6-acetamido-13-ethyl-2-methoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CC[C@@]12CCC[C@H]1[C@@H]1C[C@H](NC(C)=O)c3cc(OS(N)(=O)=O)c(OC)cc3[C@H]1CC2 |
| InChI | InChI=1S/C22H32N2O5S/c1-4-22-8-5-6-18(22)16-10-19(24-13(2)25)17-12-21(29-30(23,26)27)20(28-3)11-15(17)14(16)7-9-22/h11-12,14,16,18-19H,4-10H2,1-3H3,(H,24,25)(H2,23,26,27)/t14-,16-,18+,19+,22+/m1/s1 |
| InChIKey | XYQCYDOHJLUZPT-HEQLHBKPSA-N |
| XLogP | 3.55 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |