C20H29NO5S — CID 91406242
[(13S)-2-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 91406242) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is [(13S)-2-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(13S)-2-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 91406242 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(13S)-2-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | C[C@@]12CCCC1C1CCc3cc(OS(N)(=O)=O)c(OCCO)cc3C1CC2 |
| InChI | InChI=1S/C20H29NO5S/c1-20-7-2-3-17(20)15-5-4-13-11-19(26-27(21,23)24)18(25-10-9-22)12-16(13)14(15)6-8-20/h11-12,14-15,17,22H,2-10H2,1H3,(H2,21,23,24)/t14?,15?,17?,20-/m0/s1 |
| InChIKey | AYUMYNJMTPOFOB-ZXGDDTLZSA-N |
| XLogP | 2.89 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |