C20H28O6S2 — CID 98564597
[(8S,9S,13R,14S,17S)-13-methyl-3-methylsulfonyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate (PubChem CID 98564597) has the molecular formula C20H28O6S2 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(8S,9S,13R,14S,17S)-13-methyl-3-methylsulfonyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate.
| Compound Name | [(8S,9S,13R,14S,17S)-13-methyl-3-methylsulfonyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate |
|---|---|
| PubChem CID | 98564597 |
| Molecular Formula | C20H28O6S2 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [(8S,9S,13R,14S,17S)-13-methyl-3-methylsulfonyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate |
| SMILES | C[C@@]12CC[C@@H]3c4ccc(OS(C)(=O)=O)cc4CC[C@@H]3[C@@H]1CC[C@@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C20H28O6S2/c1-20-11-10-16-15-7-5-14(25-27(2,21)22)12-13(15)4-6-17(16)18(20)8-9-19(20)26-28(3,23)24/h5,7,12,16-19H,4,6,8-11H2,1-3H3/t16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | UCSAVZDSDBVTDJ-JAZQRGJZSA-N |
| XLogP | 3.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|