C21H28O4 — CID 165351097
[(8R,9S,13S,14S,17S)-3-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] formate (PubChem CID 165351097) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-3-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] formate.
| Compound Name | [(8R,9S,13S,14S,17S)-3-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] formate |
|---|---|
| PubChem CID | 165351097 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-3-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] formate |
| SMILES | COCOc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O4/c1-21-10-9-17-16-6-4-15(25-13-23-2)11-14(16)3-5-18(17)19(21)7-8-20(21)24-12-22/h4,6,11-12,17-20H,3,5,7-10,13H2,1-2H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | YTUDGTURAWMTRF-MJCUULBUSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|