C18H24N2O4S — CID 68616826
[[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-13-carbonyl]amino]sulfamic acid (PubChem CID 68616826) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is [[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-13-carbonyl]amino]sulfamic acid.
| Compound Name | [[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-13-carbonyl]amino]sulfamic acid |
|---|---|
| PubChem CID | 68616826 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [[(8R,9S,13R,14S)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-13-carbonyl]amino]sulfamic acid |
| SMILES | O=C(NNS(=O)(=O)O)[C@@]12CCC[C@H]1[C@@H]1CCc3ccccc3[C@H]1CC2 |
| InChI | InChI=1S/C18H24N2O4S/c21-17(19-20-25(22,23)24)18-10-3-6-16(18)15-8-7-12-4-1-2-5-13(12)14(15)9-11-18/h1-2,4-5,14-16,20H,3,6-11H2,(H,19,21)(H,22,23,24)/t14-,15-,16+,18-/m1/s1 |
| InChIKey | HUNJHNFDBIFFCP-XLMAVXFVSA-N |
| XLogP | 2.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|