C20H26O2 — CID 175889548
2-[(8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 175889548) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 175889548 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[(8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccccc4CC[C@H]3[C@@H]1CCC2CC(=O)O |
| InChI | InChI=1S/C20H26O2/c1-20-11-10-16-15-5-3-2-4-13(15)6-8-17(16)18(20)9-7-14(20)12-19(21)22/h2-5,14,16-18H,6-12H2,1H3,(H,21,22)/t14?,16-,17-,18+,20-/m1/s1 |
| InChIKey | VYVLKKOGRMHOJV-YBHUCMTOSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |