C22H27NO3Se — CID 175358192
2-[(8S,9S,13R,14S)-3-methoxy-13-methyl-2-selenocyanato-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 175358192) has the molecular formula C22H27NO3Se and a molecular weight of 432.42 g/mol. Its IUPAC name is 2-[(8S,9S,13R,14S)-3-methoxy-13-methyl-2-selenocyanato-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(8S,9S,13R,14S)-3-methoxy-13-methyl-2-selenocyanato-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 175358192 |
| Molecular Formula | C22H27NO3Se |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[(8S,9S,13R,14S)-3-methoxy-13-methyl-2-selenocyanato-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | COc1cc2c(cc1[Se]C#N)[C@H]1CC[C@]3(C)C(CC(=O)O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C22H27NO3Se/c1-22-8-7-15-16(18(22)6-4-14(22)10-21(24)25)5-3-13-9-19(26-2)20(27-12-23)11-17(13)15/h9,11,14-16,18H,3-8,10H2,1-2H3,(H,24,25)/t14?,15-,16+,18-,22+/m0/s1 |
| InChIKey | PVBYYEJDQRGHOA-IPIBJMJISA-N |
| XLogP | 3.45 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|