C24H35NO5S — CID 58636533
ethyl 2-[(13R,17R)-2-ethyl-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetate (PubChem CID 58636533) has the molecular formula C24H35NO5S and a molecular weight of 449.61 g/mol. Its IUPAC name is ethyl 2-[(13R,17R)-2-ethyl-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetate.
| Compound Name | ethyl 2-[(13R,17R)-2-ethyl-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetate |
|---|---|
| PubChem CID | 58636533 |
| Molecular Formula | C24H35NO5S |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | ethyl 2-[(13R,17R)-2-ethyl-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCC2C3CCc4cc(OS(N)(=O)=O)c(CC)cc4C3CC[C@@]21C |
| InChI | InChI=1S/C24H35NO5S/c1-4-15-12-20-16(13-22(15)30-31(25,27)28)6-8-19-18(20)10-11-24(3)17(7-9-21(19)24)14-23(26)29-5-2/h12-13,17-19,21H,4-11,14H2,1-3H3,(H2,25,27,28)/t17-,18?,19?,21?,24-/m1/s1 |
| InChIKey | JNDBZEZGHWLWCM-FMKDPPQASA-N |
| XLogP | 4.26 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |