C22H32O3S — CID 46197020
(8S,9S,13S,14S,17S)-2-ethyl-13-methyl-17-(methylsulfonylmethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 46197020) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-2-ethyl-13-methyl-17-(methylsulfonylmethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13S,14S,17S)-2-ethyl-13-methyl-17-(methylsulfonylmethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 46197020 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (8S,9S,13S,14S,17S)-2-ethyl-13-methyl-17-(methylsulfonylmethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](CS(C)(=O)=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H32O3S/c1-4-14-11-19-15(12-21(14)23)5-7-18-17(19)9-10-22(2)16(6-8-20(18)22)13-26(3,24)25/h11-12,16-18,20,23H,4-10,13H2,1-3H3/t16-,17+,18-,20+,22-/m1/s1 |
| InChIKey | APXURFRLZFHVEA-GNYGEYGVSA-N |
| XLogP | 4.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |