C24H33NO2 — CID 58972059
(13R,17R)-17-(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 58972059) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (13R,17R)-17-(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (13R,17R)-17-(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 58972059 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (13R,17R)-17-(4,5-dihydro-1,3-oxazol-2-ylmethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCc1cc2c(cc1O)CCC1C2CC[C@@]2(C)C1CC[C@@H]2CC1=NCCO1 |
| InChI | InChI=1S/C24H33NO2/c1-3-15-12-20-16(13-22(15)26)4-6-19-18(20)8-9-24(2)17(5-7-21(19)24)14-23-25-10-11-27-23/h12-13,17-19,21,26H,3-11,14H2,1-2H3/t17-,18?,19?,21?,24-/m1/s1 |
| InChIKey | MEHFSVKAWLDVQV-FMKDPPQASA-N |
| XLogP | 5.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |