C22H30O2 — CID 58636481
(13S,17E)-2-ethyl-17-(2-hydroxyethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 58636481) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (13S,17E)-2-ethyl-17-(2-hydroxyethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (13S,17E)-2-ethyl-17-(2-hydroxyethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 58636481 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (13S,17E)-2-ethyl-17-(2-hydroxyethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCc1cc2c(cc1O)CCC1C2CC[C@]2(C)/C(=C/CO)CCC12 |
| InChI | InChI=1S/C22H30O2/c1-3-14-12-19-15(13-21(14)24)4-6-18-17(19)8-10-22(2)16(9-11-23)5-7-20(18)22/h9,12-13,17-18,20,23-24H,3-8,10-11H2,1-2H3/b16-9+/t17?,18?,20?,22-/m1/s1 |
| InChIKey | ULWPFRRVBLSYOS-MXMPOJLLSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|