C22H30F2O — CID 58972069
(13R,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 58972069) has the molecular formula C22H30F2O and a molecular weight of 348.48 g/mol. Its IUPAC name is (13R,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (13R,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 58972069 |
| Molecular Formula | C22H30F2O |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (13R,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCc1cc2c(cc1O)CCC1C2CC[C@@]2(C)C1CC[C@@H]2CC(F)F |
| InChI | InChI=1S/C22H30F2O/c1-3-13-10-18-14(11-20(13)25)4-6-17-16(18)8-9-22(2)15(12-21(23)24)5-7-19(17)22/h10-11,15-17,19,21,25H,3-9,12H2,1-2H3/t15-,16?,17?,19?,22-/m1/s1 |
| InChIKey | XYGBUNZVYHRDQT-POCDQCLASA-N |
| XLogP | 6.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |