C23H29NO — CID 11163473
(2E)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]propanenitrile (PubChem CID 11163473) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (2E)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]propanenitrile.
| Compound Name | (2E)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]propanenitrile |
|---|---|
| PubChem CID | 11163473 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2E)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]propanenitrile |
| SMILES | CCc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=C(\C)C#N)CC[C@@H]12 |
| InChI | InChI=1S/C23H29NO/c1-4-15-11-19-16(12-22(15)25)5-6-18-17(19)9-10-23(3)20(14(2)13-24)7-8-21(18)23/h11-12,17-18,21,25H,4-10H2,1-3H3/b20-14+/t17-,18+,21-,23+/m0/s1 |
| InChIKey | JJOKGTHQMACJCF-YWYFCSRCSA-N |
| XLogP | 5.65 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|