C22H24N2O2 — CID 10736500
2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]methyl]propanedinitrile (PubChem CID 10736500) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]methyl]propanedinitrile.
| Compound Name | 2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]methyl]propanedinitrile |
|---|---|
| PubChem CID | 10736500 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-2-yl]methyl]propanedinitrile |
| SMILES | C[C@]12CC[C@@H]3c4cc(CC(C#N)C#N)c(O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C22H24N2O2/c1-22-7-6-16-17(19(22)4-5-21(22)26)3-2-14-10-20(25)15(9-18(14)16)8-13(11-23)12-24/h9-10,13,16-17,19,25H,2-8H2,1H3/t16-,17+,19-,22-/m0/s1 |
| InChIKey | BVTCESGCOQPSHF-YZIUBNRHSA-N |
| XLogP | 4.02 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |