C28H36O2 — CID 90900973
(8R,9S,13S,14S)-2-(2-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 90900973) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-(2-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-(2-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 90900973 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (8R,9S,13S,14S)-2-(2-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(C5C6CC7CC(C6)CC5C7)c(O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C28H36O2/c1-28-7-6-20-21(24(28)4-5-26(28)30)3-2-17-13-25(29)23(14-22(17)20)27-18-9-15-8-16(11-18)12-19(27)10-15/h13-16,18-21,24,27,29H,2-12H2,1H3/t15?,16?,18?,19?,20-,21+,24-,27?,28-/m0/s1 |
| InChIKey | PRDBIMNVCFCMFB-KMPUNIEGSA-N |
| XLogP | 6.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |