C24H38OSi2 — CID 22809806
(8R,9S,13S,14S)-13-methyl-2,3-bis(trimethylsilyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 22809806) has the molecular formula C24H38OSi2 and a molecular weight of 398.74 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-2,3-bis(trimethylsilyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-2,3-bis(trimethylsilyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22809806 |
| Molecular Formula | C24H38OSi2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-2,3-bis(trimethylsilyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cc([Si](C)(C)C)c([Si](C)(C)C)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H38OSi2/c1-24-13-12-17-18(20(24)10-11-23(24)25)9-8-16-14-21(26(2,3)4)22(15-19(16)17)27(5,6)7/h14-15,17-18,20H,8-13H2,1-7H3/t17-,18+,20-,24-/m0/s1 |
| InChIKey | IBBSUXIGGVITOP-KBVWPGPTSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|