C28H38O2 — CID 143147661
(13S)-3-hydroxy-13-methyl-2-(3-methyl-3-bicyclo[3.3.1]nonanyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 143147661) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is (13S)-3-hydroxy-13-methyl-2-(3-methyl-3-bicyclo[3.3.1]nonanyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13S)-3-hydroxy-13-methyl-2-(3-methyl-3-bicyclo[3.3.1]nonanyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 143147661 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (13S)-3-hydroxy-13-methyl-2-(3-methyl-3-bicyclo[3.3.1]nonanyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC1(c2cc3c(cc2O)CCC2C3CC[C@]3(C)C(=O)CCC23)CC2CCCC(C2)C1 |
| InChI | InChI=1S/C28H38O2/c1-27(15-17-4-3-5-18(12-17)16-27)24-14-22-19(13-25(24)29)6-7-21-20(22)10-11-28(2)23(21)8-9-26(28)30/h13-14,17-18,20-21,23,29H,3-12,15-16H2,1-2H3/t17?,18?,20?,21?,23?,27?,28-/m0/s1 |
| InChIKey | RJFSJRPLZZBCMG-ASLDFRGJSA-N |
| XLogP | 6.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |