C30H43NO2 — CID 143475293
(13S,17E)-2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 143475293) has the molecular formula C30H43NO2 and a molecular weight of 449.68 g/mol. Its IUPAC name is (13S,17E)-2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (13S,17E)-2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 143475293 |
| Molecular Formula | C30H43NO2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | (13S,17E)-2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CO/N=C1\CCC2C3CCc4cc(O)c(C5(C)CC6CC(C)CC(C6)C5)cc4C3CC[C@]12C |
| InChI | InChI=1S/C30H43NO2/c1-18-11-19-13-20(12-18)17-29(2,16-19)26-15-24-21(14-27(26)32)5-6-23-22(24)9-10-30(3)25(23)7-8-28(30)31-33-4/h14-15,18-20,22-23,25,32H,5-13,16-17H2,1-4H3/b31-28+/t18?,19?,20?,22?,23?,25?,29?,30-/m0/s1 |
| InChIKey | PUSZPTWIZQXYPP-LBNLNDMYSA-N |
| XLogP | 7.35 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|