C31H41NO4 — CID 24992809
methyl 2-[(E)-[(13S)-2-(1-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]oxyacetate (PubChem CID 24992809) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is methyl 2-[(E)-[(13S)-2-(1-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]oxyacetate.
| Compound Name | methyl 2-[(E)-[(13S)-2-(1-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 24992809 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | methyl 2-[(E)-[(13S)-2-(1-adamantyl)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]oxyacetate |
| SMILES | COC(=O)CO/N=C1\CCC2C3CCc4cc(O)c(C56CC7CC(CC(C7)C5)C6)cc4C3CC[C@]12C |
| InChI | InChI=1S/C31H41NO4/c1-30-8-7-22-23(25(30)5-6-28(30)32-36-17-29(34)35-2)4-3-21-12-27(33)26(13-24(21)22)31-14-18-9-19(15-31)11-20(10-18)16-31/h12-13,18-20,22-23,25,33H,3-11,14-17H2,1-2H3/b32-28+/t18?,19?,20?,22?,23?,25?,30-,31?/m0/s1 |
| InChIKey | HVUMRKMQERHVNX-SSCUIECJSA-N |
| XLogP | 6.26 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|