C20H27NO3 — CID 20845660
(8R,9S,13S,14S,17E)-6-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 20845660) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (8R,9S,13S,14S,17E)-6-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,13S,14S,17E)-6-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 20845660 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (8R,9S,13S,14S,17E)-6-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CO/N=C1\CC[C@H]2[C@@H]3CC(OC)c4cc(O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H27NO3/c1-20-9-8-14-13-5-4-12(22)10-16(13)18(23-2)11-15(14)17(20)6-7-19(20)21-24-3/h4-5,10,14-15,17-18,22H,6-9,11H2,1-3H3/b21-19+/t14-,15-,17+,18?,20+/m1/s1 |
| InChIKey | MXWCKFRFVBEESY-BKNMRANUSA-N |
| XLogP | 4.40 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|