C20H27NO3 — CID 131884433
(8R,9S,13S,14S)-3-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-ol (PubChem CID 131884433) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-ol.
| Compound Name | (8R,9S,13S,14S)-3-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-ol |
|---|---|
| PubChem CID | 131884433 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (8R,9S,13S,14S)-3-methoxy-17-methoxyimino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-ol |
| SMILES | CON=C1CC[C@H]2[C@@H]3CCc4c(ccc(OC)c4O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H27NO3/c1-20-11-10-13-12-6-8-17(23-2)19(22)15(12)5-4-14(13)16(20)7-9-18(20)21-24-3/h6,8,13-14,16,22H,4-5,7,9-11H2,1-3H3/t13-,14-,16+,20+/m1/s1 |
| InChIKey | HSTWPOQBTAKMFS-NKSTXHLWSA-N |
| XLogP | 4.26 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|