C23H35NO3Si — CID 101280448
(Z,6S,8R,9S,13S,14S)-N,6-dimethoxy-13-methyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine (PubChem CID 101280448) has the molecular formula C23H35NO3Si and a molecular weight of 401.62 g/mol. Its IUPAC name is (Z,6S,8R,9S,13S,14S)-N,6-dimethoxy-13-methyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine.
| Compound Name | (Z,6S,8R,9S,13S,14S)-N,6-dimethoxy-13-methyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 101280448 |
| Molecular Formula | C23H35NO3Si |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (Z,6S,8R,9S,13S,14S)-N,6-dimethoxy-13-methyl-3-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-imine |
| SMILES | CO/N=C1/CC[C@H]2[C@@H]3C[C@H](OC)c4cc(O[Si](C)(C)C)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H35NO3Si/c1-23-12-11-17-16-8-7-15(27-28(4,5)6)13-19(16)21(25-2)14-18(17)20(23)9-10-22(23)24-26-3/h7-8,13,17-18,20-21H,9-12,14H2,1-6H3/b24-22-/t17-,18-,20+,21+,23+/m1/s1 |
| InChIKey | KJBREHYVQGFTTO-MEJCZPOPSA-N |
| XLogP | 5.90 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|