C27H48O3Si3 — CID 552535
trimethyl-[[13-methyl-3,6-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane (PubChem CID 552535) has the molecular formula C27H48O3Si3 and a molecular weight of 504.94 g/mol. Its IUPAC name is trimethyl-[[13-methyl-3,6-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane.
| Compound Name | trimethyl-[[13-methyl-3,6-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
|---|---|
| PubChem CID | 552535 |
| Molecular Formula | C27H48O3Si3 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | trimethyl-[[13-methyl-3,6-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
| SMILES | CC12CCC3c4ccc(O[Si](C)(C)C)cc4C(O[Si](C)(C)C)CC3C1CCC2O[Si](C)(C)C |
| InChI | InChI=1S/C27H48O3Si3/c1-27-16-15-21-20-12-11-19(28-31(2,3)4)17-23(20)25(29-32(5,6)7)18-22(21)24(27)13-14-26(27)30-33(8,9)10/h11-12,17,21-22,24-26H,13-16,18H2,1-10H3 |
| InChIKey | FRIBZTQDVPICCL-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|