C27H48O3Si3 — CID 101281731
trimethyl-[[(8R,9S,13S,14S,15R,17S)-13-methyl-3,15-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane (PubChem CID 101281731) has the molecular formula C27H48O3Si3 and a molecular weight of 504.94 g/mol. Its IUPAC name is trimethyl-[[(8R,9S,13S,14S,15R,17S)-13-methyl-3,15-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane.
| Compound Name | trimethyl-[[(8R,9S,13S,14S,15R,17S)-13-methyl-3,15-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
|---|---|
| PubChem CID | 101281731 |
| Molecular Formula | C27H48O3Si3 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | trimethyl-[[(8R,9S,13S,14S,15R,17S)-13-methyl-3,15-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O[Si](C)(C)C)cc4CC[C@H]3[C@@H]1[C@H](O[Si](C)(C)C)C[C@@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C27H48O3Si3/c1-27-16-15-22-21-14-12-20(28-31(2,3)4)17-19(21)11-13-23(22)26(27)24(29-32(5,6)7)18-25(27)30-33(8,9)10/h12,14,17,22-26H,11,13,15-16,18H2,1-10H3/t22-,23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | DHXJGULBWLAVHF-XLKYERIQSA-N |
| XLogP | 7.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|