C24H38O3Si2 — CID 634458
13-methyl-3,12-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 634458) has the molecular formula C24H38O3Si2 and a molecular weight of 430.74 g/mol. Its IUPAC name is 13-methyl-3,12-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 13-methyl-3,12-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 634458 |
| Molecular Formula | C24H38O3Si2 |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 13-methyl-3,12-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12C(=O)CCC1C1CCc3cc(O[Si](C)(C)C)ccc3C1CC2O[Si](C)(C)C |
| InChI | InChI=1S/C24H38O3Si2/c1-24-21(12-13-22(24)25)19-10-8-16-14-17(26-28(2,3)4)9-11-18(16)20(19)15-23(24)27-29(5,6)7/h9,11,14,19-21,23H,8,10,12-13,15H2,1-7H3 |
| InChIKey | NHGCCMYUKXSPLL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|