C30H56O4Si4 — CID 526037
trimethyl-[[13-methyl-3,15,16-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane (PubChem CID 526037) has the molecular formula C30H56O4Si4 and a molecular weight of 593.12 g/mol. Its IUPAC name is trimethyl-[[13-methyl-3,15,16-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane.
| Compound Name | trimethyl-[[13-methyl-3,15,16-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
|---|---|
| PubChem CID | 526037 |
| Molecular Formula | C30H56O4Si4 |
| Molecular Weight | 593.12 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | trimethyl-[[13-methyl-3,15,16-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
| SMILES | CC12CCC3c4ccc(O[Si](C)(C)C)cc4CCC3C1C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C |
| InChI | InChI=1S/C30H56O4Si4/c1-30-19-18-24-23-17-15-22(31-35(2,3)4)20-21(23)14-16-25(24)26(30)27(32-36(5,6)7)28(33-37(8,9)10)29(30)34-38(11,12)13/h15,17,20,24-29H,14,16,18-19H2,1-13H3 |
| InChIKey | RSQDODOMVGFYEA-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.12 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|