C23H35NO3Si — CID 101281749
(Z,8R,9S,13S,14S,17R)-N,3-dimethoxy-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-16-imine (PubChem CID 101281749) has the molecular formula C23H35NO3Si and a molecular weight of 401.62 g/mol. Its IUPAC name is (Z,8R,9S,13S,14S,17R)-N,3-dimethoxy-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-16-imine.
| Compound Name | (Z,8R,9S,13S,14S,17R)-N,3-dimethoxy-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-16-imine |
|---|---|
| PubChem CID | 101281749 |
| Molecular Formula | C23H35NO3Si |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (Z,8R,9S,13S,14S,17R)-N,3-dimethoxy-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-16-imine |
| SMILES | CO/N=C1/C[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@]2(C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C23H35NO3Si/c1-23-12-11-18-17-10-8-16(25-2)13-15(17)7-9-19(18)20(23)14-21(24-26-3)22(23)27-28(4,5)6/h8,10,13,18-20,22H,7,9,11-12,14H2,1-6H3/b24-21-/t18-,19-,20+,22+,23+/m1/s1 |
| InChIKey | SIQATVKXZKXVDA-WUWBWWPRSA-N |
| XLogP | 5.38 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|