C19H26O3 — CID 125481225
(1R,3aS,3bR,9bS,11aS)-1,7-dimethoxy-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran (PubChem CID 125481225) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (1R,3aS,3bR,9bS,11aS)-1,7-dimethoxy-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran.
| Compound Name | (1R,3aS,3bR,9bS,11aS)-1,7-dimethoxy-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran |
|---|---|
| PubChem CID | 125481225 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1R,3aS,3bR,9bS,11aS)-1,7-dimethoxy-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@H](OC)OC[C@@H]12 |
| InChI | InChI=1S/C19H26O3/c1-19-9-8-15-14-7-5-13(20-2)10-12(14)4-6-16(15)17(19)11-22-18(19)21-3/h5,7,10,15-18H,4,6,8-9,11H2,1-3H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | PIAFYQWRSNCWID-FQBWVUSXSA-N |
| XLogP | 3.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |