C21H28O3Si — CID 632074
13-methyl-3-trimethylsilyloxy-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione (PubChem CID 632074) has the molecular formula C21H28O3Si and a molecular weight of 356.54 g/mol. Its IUPAC name is 13-methyl-3-trimethylsilyloxy-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | 13-methyl-3-trimethylsilyloxy-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 632074 |
| Molecular Formula | C21H28O3Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 13-methyl-3-trimethylsilyloxy-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione |
| SMILES | CC12CCC3c4ccc(O[Si](C)(C)C)cc4CC(=O)C3C1CCC2=O |
| InChI | InChI=1S/C21H28O3Si/c1-21-10-9-16-15-6-5-14(24-25(2,3)4)11-13(15)12-18(22)20(16)17(21)7-8-19(21)23/h5-6,11,16-17,20H,7-10,12H2,1-4H3 |
| InChIKey | SWZLLIGCDVTNEX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|