C18H20O3 — CID 22295748
(8R,9S,13S,14S)-3-hydroxy-13-methyl-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione (PubChem CID 22295748) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 22295748 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-7,17-dione |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC(=O)[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H20O3/c1-18-7-6-13-12-3-2-11(19)8-10(12)9-15(20)17(13)14(18)4-5-16(18)21/h2-3,8,13-14,17,19H,4-7,9H2,1H3/t13-,14+,17-,18+/m1/s1 |
| InChIKey | QYRASKQOZQGHDA-NONVJHHQSA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |