C30H56O4Si4 — CID 101280455
trimethyl-[[(8R,9S,13S,14S,17S)-13-methyl-2,3,4-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane (PubChem CID 101280455) has the molecular formula C30H56O4Si4 and a molecular weight of 593.12 g/mol. Its IUPAC name is trimethyl-[[(8R,9S,13S,14S,17S)-13-methyl-2,3,4-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane.
| Compound Name | trimethyl-[[(8R,9S,13S,14S,17S)-13-methyl-2,3,4-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
|---|---|
| PubChem CID | 101280455 |
| Molecular Formula | C30H56O4Si4 |
| Molecular Weight | 593.12 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | trimethyl-[[(8R,9S,13S,14S,17S)-13-methyl-2,3,4-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]silane |
| SMILES | C[C@]12CC[C@@H]3c4cc(O[Si](C)(C)C)c(O[Si](C)(C)C)c(O[Si](C)(C)C)c4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C30H56O4Si4/c1-30-19-18-21-22(25(30)16-17-27(30)32-36(5,6)7)14-15-23-24(21)20-26(31-35(2,3)4)29(34-38(11,12)13)28(23)33-37(8,9)10/h20-22,25,27H,14-19H2,1-13H3/t21-,22+,25-,27-,30-/m0/s1 |
| InChIKey | UWDHNDWYRXTKRZ-VCUCZGFVSA-N |
| XLogP | 9.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.12 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|