C27H49NO3Si3 — CID 22297087
(8R,9S,13S,14S,16R,17R)-13-methyl-3,16,17-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-amine (PubChem CID 22297087) has the molecular formula C27H49NO3Si3 and a molecular weight of 519.95 g/mol. Its IUPAC name is (8R,9S,13S,14S,16R,17R)-13-methyl-3,16,17-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-amine.
| Compound Name | (8R,9S,13S,14S,16R,17R)-13-methyl-3,16,17-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-amine |
|---|---|
| PubChem CID | 22297087 |
| Molecular Formula | C27H49NO3Si3 |
| Molecular Weight | 519.95 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | (8R,9S,13S,14S,16R,17R)-13-methyl-3,16,17-tris(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-amine |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O[Si](C)(C)C)c(N)c4CC[C@H]3[C@@H]1C[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C27H49NO3Si3/c1-27-16-15-19-18-13-14-23(29-32(2,3)4)25(28)21(18)12-11-20(19)22(27)17-24(30-33(5,6)7)26(27)31-34(8,9)10/h13-14,19-20,22,24,26H,11-12,15-17,28H2,1-10H3/t19-,20-,22+,24-,26+,27+/m1/s1 |
| InChIKey | YUXPFICZFDXVJP-OAZUCODASA-N |
| XLogP | 7.39 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.95 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|