C28H56O3Si3 — CID 6431622
[(3S,5S,10S,13S,16R,17R)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 6431622) has the molecular formula C28H56O3Si3 and a molecular weight of 525.01 g/mol. Its IUPAC name is [(3S,5S,10S,13S,16R,17R)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(3S,5S,10S,13S,16R,17R)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 6431622 |
| Molecular Formula | C28H56O3Si3 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | [(3S,5S,10S,13S,16R,17R)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | C[C@]12CCC3C(CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]34C)C1C[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C28H56O3Si3/c1-27-16-14-21(29-32(3,4)5)18-20(27)12-13-22-23(27)15-17-28(2)24(22)19-25(30-33(6,7)8)26(28)31-34(9,10)11/h20-26H,12-19H2,1-11H3/t20-,21-,22?,23?,24?,25+,26-,27-,28-/m0/s1 |
| InChIKey | RQCSPBXXGJRUKU-GJQXRMMLSA-N |
| XLogP | 8.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|