C30H60O3Si3 — CID 91750911
1-[(5S,10S,13S,17S)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane (PubChem CID 91750911) has the molecular formula C30H60O3Si3 and a molecular weight of 553.07 g/mol. Its IUPAC name is 1-[(5S,10S,13S,17S)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane.
| Compound Name | 1-[(5S,10S,13S,17S)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane |
|---|---|
| PubChem CID | 91750911 |
| Molecular Formula | C30H60O3Si3 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.39 |
| IUPAC Name | 1-[(5S,10S,13S,17S)-10,13-dimethyl-3,16-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane |
| SMILES | CC(O[Si](C)(C)C)[C@H]1C(O[Si](C)(C)C)CC2C3CC[C@H]4CC(O[Si](C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H60O3Si3/c1-21(31-34(4,5)6)28-27(33-36(10,11)12)20-26-24-14-13-22-19-23(32-35(7,8)9)15-17-29(22,2)25(24)16-18-30(26,28)3/h21-28H,13-20H2,1-12H3/t21?,22-,23?,24?,25?,26?,27?,28-,29-,30-/m0/s1 |
| InChIKey | GKSDWCMXICLASA-WMKJXIITSA-N |
| XLogP | 8.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|