C33H68O4Si4 — CID 552446
[17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 552446) has the molecular formula C33H68O4Si4 and a molecular weight of 641.25 g/mol. Its IUPAC name is [17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 552446 |
| Molecular Formula | C33H68O4Si4 |
| Molecular Weight | 641.25 g/mol |
| Exact Mass | 640.42 |
| IUPAC Name | [17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | CC12CCC(O[Si](C)(C)C)CC1CCC1C2CCC2(C)C1CCC2(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C33H68O4Si4/c1-31-20-17-26(35-39(6,7)8)23-25(31)15-16-27-28(31)18-21-32(2)29(27)19-22-33(32,37-41(12,13)14)30(36-40(9,10)11)24-34-38(3,4)5/h25-30H,15-24H2,1-14H3 |
| InChIKey | IBODYFABLWYOGQ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.25 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|