C18H26N2O7S2 — CID 87976467
[(8R,9S,13S,14S,16R,17R)-3-hydroxy-13-methyl-16-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate (PubChem CID 87976467) has the molecular formula C18H26N2O7S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16R,17R)-3-hydroxy-13-methyl-16-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate.
| Compound Name | [(8R,9S,13S,14S,16R,17R)-3-hydroxy-13-methyl-16-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
|---|---|
| PubChem CID | 87976467 |
| Molecular Formula | C18H26N2O7S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [(8R,9S,13S,14S,16R,17R)-3-hydroxy-13-methyl-16-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C[C@@H](OS(N)(=O)=O)[C@@H]2OS(N)(=O)=O |
| InChI | InChI=1S/C18H26N2O7S2/c1-18-7-6-13-12-5-3-11(21)8-10(12)2-4-14(13)15(18)9-16(26-28(19,22)23)17(18)27-29(20,24)25/h3,5,8,13-17,21H,2,4,6-7,9H2,1H3,(H2,19,22,23)(H2,20,24,25)/t13-,14-,15+,16-,17+,18+/m1/s1 |
| InChIKey | KVOGPYAMKQIYSE-ZXXIGWHRSA-N |
| XLogP | 1.04 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |