C18H25FN2O6S2 — CID 91589139
[(8R,9S,13S,14S,17R)-16-fluoro-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate (PubChem CID 91589139) has the molecular formula C18H25FN2O6S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-16-fluoro-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate.
| Compound Name | [(8R,9S,13S,14S,17R)-16-fluoro-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
|---|---|
| PubChem CID | 91589139 |
| Molecular Formula | C18H25FN2O6S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-16-fluoro-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OS(N)(=O)=O)cc4CC[C@H]3[C@@H]1CC(F)[C@@H]2OS(N)(=O)=O |
| InChI | InChI=1S/C18H25FN2O6S2/c1-18-7-6-13-12-5-3-11(26-28(20,22)23)8-10(12)2-4-14(13)15(18)9-16(19)17(18)27-29(21,24)25/h3,5,8,13-17H,2,4,6-7,9H2,1H3,(H2,20,22,23)(H2,21,24,25)/t13-,14-,15+,16?,17+,18+/m1/s1 |
| InChIKey | VYHASIXIUIUGKR-ZKWAUYSQSA-N |
| XLogP | 1.66 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |