C22H33NO5S — CID 15340500
[(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate (PubChem CID 15340500) has the molecular formula C22H33NO5S and a molecular weight of 423.58 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate.
| Compound Name | [(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate |
|---|---|
| PubChem CID | 15340500 |
| Molecular Formula | C22H33NO5S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | [(8R,9S,13S,14S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate |
| SMILES | CCN(CC)S(=O)(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C22H33NO5S/c1-4-23(5-2)29(26,27)28-15-7-9-16-14(12-15)6-8-18-17(16)10-11-22(3)19(18)13-20(24)21(22)25/h7,9,12,17-21,24-25H,4-6,8,10-11,13H2,1-3H3/t17-,18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | FGDLTISKHVMBLB-BTOHRNCKSA-N |
| XLogP | 2.84 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |