C22H28O4 — CID 146220178
[(13S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] cyclopropanecarboxylate (PubChem CID 146220178) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(13S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] cyclopropanecarboxylate.
| Compound Name | [(13S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 146220178 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(13S,16R,17R)-16,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] cyclopropanecarboxylate |
| SMILES | C[C@]12CCC3c4ccc(OC(=O)C5CC5)cc4CCC3C1C[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C22H28O4/c1-22-9-8-16-15-7-5-14(26-21(25)12-2-3-12)10-13(15)4-6-17(16)18(22)11-19(23)20(22)24/h5,7,10,12,16-20,23-24H,2-4,6,8-9,11H2,1H3/t16?,17?,18?,19-,20+,22+/m1/s1 |
| InChIKey | QAWKUNGEGZGRBK-WIKWSJDLSA-N |
| XLogP | 3.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|